Structure of PDB 4np3 Chain A Binding Site BS01 |
|
|
Ligand ID | 2L2 |
InChI | InChI=1S/C14H18N4/c1-10-14(17-9-16-10)8-18-6-5-11-3-2-4-13(15)12(11)7-18/h2-4,9H,5-8,15H2,1H3,(H,16,17) |
InChIKey | IMWCZDDKZOUUNI-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1nc[nH]c1CN2CCc3cccc(N)c3C2 | OpenEye OEToolkits 1.7.6 | Cc1c([nH]cn1)CN2CCc3cccc(c3C2)N | ACDLabs 12.01 | n1c(c(nc1)CN3Cc2c(cccc2N)CC3)C |
|
Formula | C14 H18 N4 |
Name | 2-[(4-methyl-1H-imidazol-5-yl)methyl]-1,2,3,4-tetrahydroisoquinolin-8-amine |
ChEMBL | CHEMBL3237627 |
DrugBank | |
ZINC |
|
PDB chain | 4np3 Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|