Structure of PDB 4nk9 Chain A Binding Site BS01 |
|
|
Ligand ID | 2K5 |
InChI | InChI=1S/C22H25N7O3/c1-14-8-19(32-29-14)13-24-22-23-7-6-20(26-22)25-21-11-16(27-28-21)5-4-15-9-17(30-2)12-18(10-15)31-3/h6-12H,4-5,13H2,1-3H3,(H3,23,24,25,26,27,28) |
InChIKey | AQHXGQTWGFVXTB-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1cc(CCc2[nH]nc(Nc3ccnc(NCc4onc(C)c4)n3)c2)cc(OC)c1 | OpenEye OEToolkits 1.7.6 | Cc1cc(on1)CNc2nccc(n2)Nc3cc([nH]n3)CCc4cc(cc(c4)OC)OC | ACDLabs 12.01 | O(c1cc(cc(OC)c1)CCc2cc(nn2)Nc3nc(ncc3)NCc4onc(c4)C)C |
|
Formula | C22 H25 N7 O3 |
Name | N~4~-{5-[2-(3,5-dimethoxyphenyl)ethyl]-1H-pyrazol-3-yl}-N~2~-[(3-methyl-1,2-oxazol-5-yl)methyl]pyrimidine-2,4-diamine |
ChEMBL | CHEMBL2088096 |
DrugBank | |
ZINC | ZINC000084731785
|
PDB chain | 4nk9 Chain A Residue 807
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|