Structure of PDB 4nat Chain A Binding Site BS01 |
|
|
Ligand ID | 2W5 |
InChI | InChI=1S/C20H23Cl2N3O3/c1-27-17-10-18(28-2)25-19(24-17)13-5-3-4-6-14(13)20(26)23-11-12-7-8-15(21)16(22)9-12/h7-10,13-14H,3-6,11H2,1-2H3,(H,23,26)/t13-,14-/m1/s1 |
InChIKey | WLATXSVSKGEBKX-ZIAGYGMSSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Clc1ccc(cc1Cl)CNC(=O)C3CCCCC3c2nc(OC)cc(OC)n2 | CACTVS 3.385 | COc1cc(OC)nc(n1)[C@@H]2CCCC[C@H]2C(=O)NCc3ccc(Cl)c(Cl)c3 | OpenEye OEToolkits 1.7.6 | COc1cc(nc(n1)[C@@H]2CCCC[C@H]2C(=O)NCc3ccc(c(c3)Cl)Cl)OC | OpenEye OEToolkits 1.7.6 | COc1cc(nc(n1)C2CCCCC2C(=O)NCc3ccc(c(c3)Cl)Cl)OC | CACTVS 3.385 | COc1cc(OC)nc(n1)[CH]2CCCC[CH]2C(=O)NCc3ccc(Cl)c(Cl)c3 |
|
Formula | C20 H23 Cl2 N3 O3 |
Name | (1R,2R)-N-(3,4-dichlorobenzyl)-2-(4,6-dimethoxypyrimidin-2-yl)cyclohexanecarboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098208333
|
PDB chain | 4nat Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
H19 R92 S130 |
Catalytic site (residue number reindexed from 1) |
H18 R85 S123 |
Enzyme Commision number |
2.7.7.3: pantetheine-phosphate adenylyltransferase. |
|
|
|