Structure of PDB 4n14 Chain A Binding Site BS01 |
|
|
Ligand ID | WR7 |
InChI | InChI=1S/C13H14Cl3N7O4/c1-8-19-7-9(23(25)26)22(8)5-6-27-12(24)21-10(13(14,15)16)20-11-17-3-2-4-18-11/h2-4,7,10H,5-6H2,1H3,(H,21,24)(H,17,18,20)/t10-/m1/s1 |
InChIKey | ZEXHXVOGJFGTRX-SNVBAGLBSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1ncc(n1CCOC(=O)NC(C(Cl)(Cl)Cl)Nc2ncccn2)[N+](=O)[O-] | CACTVS 3.385 | Cc1ncc(n1CCOC(=O)N[C@@H](Nc2ncccn2)C(Cl)(Cl)Cl)[N+]([O-])=O | CACTVS 3.385 | Cc1ncc(n1CCOC(=O)N[CH](Nc2ncccn2)C(Cl)(Cl)Cl)[N+]([O-])=O | OpenEye OEToolkits 1.7.6 | Cc1ncc(n1CCOC(=O)N[C@H](C(Cl)(Cl)Cl)Nc2ncccn2)[N+](=O)[O-] | ACDLabs 12.01 | ClC(Cl)(Cl)C(Nc1ncccn1)NC(=O)OCCn2c(cnc2C)[N+]([O-])=O |
|
Formula | C13 H14 Cl3 N7 O4 |
Name | 2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl [(1R)-2,2,2-trichloro-1-(pyrimidin-2-ylamino)ethyl]carbamate; apcin |
ChEMBL | |
DrugBank | |
ZINC | ZINC000008434967
|
PDB chain | 4n14 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|