Structure of PDB 4mx1 Chain A Binding Site BS01 |
|
|
Ligand ID | 1MX |
InChI | InChI=1S/C16H16N8O3/c17-15-23-12-11(14(26)24-15)20-8-10(22-12)13(25)18-6-7-19-16(27)21-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H,18,25)(H2,19,21,27)(H3,17,22,23,24,26) |
InChIKey | UGNDSTADFKFZJF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | NC1=Nc2nc(cnc2C(=O)N1)C(=O)NCCNC(=O)Nc3ccccc3 | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)NC(=O)NCCNC(=O)c2cnc3c(n2)N=C(NC3=O)N | ACDLabs 12.01 | O=C(Nc1ccccc1)NCCNC(=O)c2nc3N=C(N)NC(=O)c3nc2 |
|
Formula | C16 H16 N8 O3 |
Name | 2-amino-4-oxo-N-{2-[(phenylcarbamoyl)amino]ethyl}-3,4-dihydropteridine-7-carboxamide |
ChEMBL | CHEMBL3098917 |
DrugBank | |
ZINC | ZINC000095920874
|
PDB chain | 4mx1 Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
V81 E177 R180 |
Catalytic site (residue number reindexed from 1) |
V82 E178 R181 |
Enzyme Commision number |
3.2.2.22: rRNA N-glycosylase. |
|
|
|