Structure of PDB 4mss Chain A Binding Site BS01 |
|
|
Ligand ID | 2CZ |
InChI | InChI=1S/C8H16N2O4/c1-4(11)10-5-2-9-3-6(12)8(14)7(5)13/h5-9,12-14H,2-3H2,1H3,(H,10,11)/t5-,6-,7+,8+/m0/s1 |
InChIKey | RGHXJBVAPJFIEQ-RULNZFCNSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(=O)N[C@H]1CNC[C@H](O)[C@@H](O)[C@@H]1O | ACDLabs 12.01 | O=C(NC1CNCC(O)C(O)C1O)C | OpenEye OEToolkits 1.7.6 | CC(=O)NC1CNCC(C(C1O)O)O | OpenEye OEToolkits 1.7.6 | CC(=O)N[C@H]1CNC[C@@H]([C@H]([C@@H]1O)O)O | CACTVS 3.385 | CC(=O)N[CH]1CNC[CH](O)[CH](O)[CH]1O |
|
Formula | C8 H16 N2 O4 |
Name | N-[(3S,4R,5R,6S)-4,5,6-trihydroxyazepan-3-yl]acetamide |
ChEMBL | CHEMBL538458 |
DrugBank | |
ZINC | ZINC000084835227
|
PDB chain | 4mss Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.2.1.52: beta-N-acetylhexosaminidase. |
|
|
|