Structure of PDB 4mr7 Chain A Binding Site BS01 |
|
|
Ligand ID | 2BV |
InChI | InChI=1S/C18H28Cl2NO3P/c1-13(15-7-8-17(19)18(20)9-15)21-10-16(22)12-25(23,24)11-14-5-3-2-4-6-14/h7-9,13-14,16,21-22H,2-6,10-12H2,1H3,(H,23,24)/t13-,16-/m0/s1 |
InChIKey | JGGVBBYJRQOPPA-BBRMVZONSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[CH](NC[CH](O)C[P](O)(=O)CC1CCCCC1)c2ccc(Cl)c(Cl)c2 | OpenEye OEToolkits 1.7.6 | C[C@@H](c1ccc(c(c1)Cl)Cl)NC[C@@H](CP(=O)(CC2CCCCC2)O)O | OpenEye OEToolkits 1.7.6 | CC(c1ccc(c(c1)Cl)Cl)NCC(CP(=O)(CC2CCCCC2)O)O | CACTVS 3.385 | C[C@H](NC[C@H](O)C[P](O)(=O)CC1CCCCC1)c2ccc(Cl)c(Cl)c2 | ACDLabs 12.01 | Clc1ccc(cc1Cl)C(NCC(O)CP(=O)(O)CC2CCCCC2)C |
|
Formula | C18 H28 Cl2 N O3 P |
Name | (R)-(cyclohexylmethyl)[(2S)-3-{[(1S)-1-(3,4-dichlorophenyl)ethyl]amino}-2-hydroxypropyl]phosphinic acid; CGP 54626 |
ChEMBL | CHEMBL1213187 |
DrugBank | |
ZINC | ZINC000031544793
|
PDB chain | 4mr7 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|