Structure of PDB 4mq2 Chain A Binding Site BS01 |
|
|
Ligand ID | 2C4 |
InChI | InChI=1S/C17H13ClN4O5/c1-26-16(25)8-3-4-11(18)12(6-8)20-14(23)10-5-9-7-19-17(27-2)22-13(9)21-15(10)24/h3-7H,1-2H3,(H,20,23)(H,19,21,22,24) |
InChIKey | SIVLENRHVVVPKJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COC(=O)c1ccc(Cl)c(NC(=O)C2=Cc3cnc(OC)nc3NC2=O)c1 | ACDLabs 12.01 | O=C(OC)c1cc(c(Cl)cc1)NC(=O)C3=Cc2c(nc(nc2)OC)NC3=O | OpenEye OEToolkits 1.7.6 | COc1ncc2c(n1)NC(=O)C(=C2)C(=O)Nc3cc(ccc3Cl)C(=O)OC |
|
Formula | C17 H13 Cl N4 O5 |
Name | methyl 4-chloro-3-{[(2-methoxy-7-oxo-7,8-dihydropyrido[2,3-d]pyrimidin-6-yl)carbonyl]amino}benzoate |
ChEMBL | CHEMBL3094442 |
DrugBank | |
ZINC | ZINC000095921342
|
PDB chain | 4mq2 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|