Structure of PDB 4mf0 Chain A Binding Site BS01 |
|
|
Ligand ID | 29Z |
InChI | InChI=1S/C25H24N4OS/c1-29(2)15-16-5-7-17(8-6-16)20-13-21(20)24(30)28-25-27-22-10-9-18(12-23(22)31-25)19-4-3-11-26-14-19/h3-12,14,20-21H,13,15H2,1-2H3,(H,27,28,30)/t20-,21+/m1/s1 |
InChIKey | PGABPPHMLFSKKA-RTWAWAEBSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN(C)Cc1ccc(cc1)[C@H]2C[C@@H]2C(=O)Nc3sc4cc(ccc4n3)c5cccnc5 | ACDLabs 12.01 | O=C(Nc1nc2ccc(cc2s1)c3cccnc3)C5CC5c4ccc(cc4)CN(C)C | CACTVS 3.385 | CN(C)Cc1ccc(cc1)[CH]2C[CH]2C(=O)Nc3sc4cc(ccc4n3)c5cccnc5 | OpenEye OEToolkits 1.7.6 | CN(C)Cc1ccc(cc1)C2CC2C(=O)Nc3nc4ccc(cc4s3)c5cccnc5 | OpenEye OEToolkits 1.7.6 | CN(C)Cc1ccc(cc1)[C@H]2C[C@@H]2C(=O)Nc3nc4ccc(cc4s3)c5cccnc5 |
|
Formula | C25 H24 N4 O S |
Name | (1S,2S)-2-{4-[(dimethylamino)methyl]phenyl}-N-[6-(pyridin-3-yl)-1,3-benzothiazol-2-yl]cyclopropanecarboxamide |
ChEMBL | CHEMBL3086534 |
DrugBank | |
ZINC | ZINC000095921411
|
PDB chain | 4mf0 Chain A Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|