Structure of PDB 4mcc Chain A Binding Site BS01 |
|
|
Ligand ID | 21X |
InChI | InChI=1S/C15H14N4O2S/c16-5-9-1-3-10(4-2-9)6-17-13(20)11-7-22-15-12(11)14(21)18-8-19-15/h1-4,7-8H,5-6,16H2,(H,17,20)(H,18,19,21) |
InChIKey | ZOJIHHOGTNVURO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C2NC=Nc1scc(c12)C(=O)NCc3ccc(cc3)CN | OpenEye OEToolkits 1.7.6 | c1cc(ccc1CN)CNC(=O)c2csc3c2C(=O)NC=N3 | CACTVS 3.385 | NCc1ccc(CNC(=O)c2csc3N=CNC(=O)c23)cc1 |
|
Formula | C15 H14 N4 O2 S |
Name | N-[4-(aminomethyl)benzyl]-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidine-5-carboxamide |
ChEMBL | CHEMBL2432000 |
DrugBank | |
ZINC | ZINC000095920761
|
PDB chain | 4mcc Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
P89 E116 R154 |
Catalytic site (residue number reindexed from 1) |
P89 E116 R154 |
Enzyme Commision number |
2.1.1.228: tRNA (guanine(37)-N(1))-methyltransferase. |
|
|
|