Structure of PDB 4mcb Chain A Binding Site BS01 |
|
|
Ligand ID | 21W |
InChI | InChI=1S/C19H18N6O2S/c26-17(14-10-28-19-16(14)18(27)24-11-25-19)23-8-13-3-1-12(2-4-13)7-20-9-15-21-5-6-22-15/h1-6,10-11,20H,7-9H2,(H,21,22)(H,23,26)(H,24,25,27) |
InChIKey | RLANZYKQCHLLJS-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc(ccc1CNCc2[nH]ccn2)CNC(=O)c3csc4c3C(=O)NC=N4 | ACDLabs 12.01 | O=C2NC=Nc1scc(c12)C(=O)NCc3ccc(cc3)CNCc4nccn4 | CACTVS 3.385 | O=C(NCc1ccc(CNCc2[nH]ccn2)cc1)c3csc4N=CNC(=O)c34 |
|
Formula | C19 H18 N6 O2 S |
Name | N-(4-{[(1H-imidazol-2-ylmethyl)amino]methyl}benzyl)-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidine-5-carboxamide |
ChEMBL | CHEMBL2432011 |
DrugBank | |
ZINC | ZINC000095920768
|
PDB chain | 4mcb Chain A Residue 303
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
P89 E116 R154 |
Catalytic site (residue number reindexed from 1) |
P89 E116 R154 |
Enzyme Commision number |
2.1.1.228: tRNA (guanine(37)-N(1))-methyltransferase. |
|
|
|