Structure of PDB 4mc3 Chain A Binding Site BS01 |
|
|
Ligand ID | 28U |
InChI | InChI=1S/C15H26O/c1-6-15(5,16)12-8-11-14(4)10-7-9-13(2)3/h6,9,11,16H,1,7-8,10,12H2,2-5H3/b14-11+/t15-/m0/s1 |
InChIKey | FQTLCLSUCSAZDY-GOFCXVBSSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)=CCCC(C)=CCC[C](C)(O)C=C | OpenEye OEToolkits 1.7.6 | CC(=CCCC(=CCCC(C)(C=C)O)C)C | OpenEye OEToolkits 1.7.6 | CC(=CCCC(=CCC[C@](C)(C=C)O)C)C | ACDLabs 12.01 | OC(/C=C)(CC/C=C(/CC/C=C(\C)C)C)C | CACTVS 3.385 | CC(C)=CCCC(/C)=C/CC[C@@](C)(O)C=C |
|
Formula | C15 H26 O |
Name | (3R,6E)-3,7,11-trimethyldodeca-1,6,10-trien-3-ol; trans-Nerolidol |
ChEMBL | |
DrugBank | |
ZINC | ZINC000002040970
|
PDB chain | 4mc3 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|