Structure of PDB 4m3b Chain A Binding Site BS01 |
|
|
Ligand ID | 2B2 |
InChI | InChI=1S/C14H13F3N2OS/c1-9-19-12(8-21-9)10-2-4-11(5-3-10)13(20)18-7-6-14(15,16)17/h2-5,8H,6-7H2,1H3,(H,18,20) |
InChIKey | SVHPYKNJXNVSQN-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1scc(n1)c2ccc(cc2)C(=O)NCCC(F)(F)F | OpenEye OEToolkits 1.7.6 | Cc1nc(cs1)c2ccc(cc2)C(=O)NCCC(F)(F)F | ACDLabs 12.01 | FC(F)(F)CCNC(=O)c2ccc(c1nc(sc1)C)cc2 |
|
Formula | C14 H13 F3 N2 O S |
Name | 4-(2-methyl-1,3-thiazol-4-yl)-N-(3,3,3-trifluoropropyl)benzamide |
ChEMBL | CHEMBL3286507 |
DrugBank | |
ZINC | ZINC000098208121
|
PDB chain | 4m3b Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|