Structure of PDB 4m13 Chain A Binding Site BS01 |
|
|
Ligand ID | 1E0 |
InChI | InChI=1S/C18H19N5O3/c1-2-8-26-12-7-6-11-4-3-5-15(13(11)9-12)23-10-14(21-18(20)25)16(22-23)17(19)24/h3-7,9-10H,2,8H2,1H3,(H2,19,24)(H3,20,21,25) |
InChIKey | HDLCJAZFKRTKGX-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCCOc1ccc2cccc(n3cc(NC(N)=O)c(n3)C(N)=O)c2c1 | ACDLabs 12.01 | O=C(N)Nc1cn(nc1C(=O)N)c2cccc3c2cc(OCCC)cc3 | OpenEye OEToolkits 1.7.6 | CCCOc1ccc2cccc(c2c1)n3cc(c(n3)C(=O)N)NC(=O)N |
|
Formula | C18 H19 N5 O3 |
Name | 4-(carbamoylamino)-1-(7-propoxynaphthalen-1-yl)-1H-pyrazole-3-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098207955
|
PDB chain | 4m13 Chain A Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|