Structure of PDB 4ls8 Chain A Binding Site BS01 |
|
|
Ligand ID | 1XG |
InChI | InChI=1S/C12H19NO3/c1-2-3-4-5-6-7-8-10(14)11(15)9-12(13)16/h2-3,5-6,11,15H,4,7-9H2,1H3,(H2,13,16)/b3-2+,6-5+/t11-/m1/s1 |
InChIKey | QEPYZBPOTYDXNA-IZFUEKCOSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(CC/C=C/C/C=C/C)C(O)CC(=O)N | CACTVS 3.385 | CC=CCC=CCCC(=O)[CH](O)CC(N)=O | OpenEye OEToolkits 1.7.6 | C/C=C/C/C=C/CCC(=O)[C@@H](CC(=O)N)O | OpenEye OEToolkits 1.7.6 | CC=CCC=CCCC(=O)C(CC(=O)N)O | CACTVS 3.385 | C\C=C\C\C=C\CCC(=O)[C@H](O)CC(N)=O |
|
Formula | C12 H19 N O3 |
Name | (3R,7E,10E)-3-hydroxy-4-oxododeca-7,10-dienamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000103522523
|
PDB chain | 4ls8 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|