Structure of PDB 4lgb Chain A Binding Site BS01 |
|
|
Ligand ID | 1W7 |
InChI | InChI=1S/C18H20N2O3S/c1-13-3-5-14(6-4-13)12-24(22,23)19-16-8-9-17-15(11-16)7-10-18(21)20(17)2/h3-6,8-9,11,19H,7,10,12H2,1-2H3 |
InChIKey | JKRLUDGFPXLBQG-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1ccc(cc1)CS(=O)(=O)Nc2ccc3c(c2)CCC(=O)N3C | CACTVS 3.385 | CN1C(=O)CCc2cc(N[S](=O)(=O)Cc3ccc(C)cc3)ccc12 | ACDLabs 12.01 | O=S(=O)(Nc1ccc2c(c1)CCC(=O)N2C)Cc3ccc(cc3)C |
|
Formula | C18 H20 N2 O3 S |
Name | N-(1-methyl-2-oxo-1,2,3,4-tetrahydroquinolin-6-yl)-1-(4-methylphenyl)methanesulfonamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000008962455
|
PDB chain | 4lgb Chain A Residue 900
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|