Structure of PDB 4lga Chain A Binding Site BS01 |
|
|
Ligand ID | A2O |
InChI | InChI=1S/C19H22N2O3S/c1-2-12-21-18-10-9-17(13-16(18)8-11-19(21)22)20-25(23,24)14-15-6-4-3-5-7-15/h3-7,9-10,13,20H,2,8,11-12,14H2,1H3 |
InChIKey | WJJPXAGBDPXKEP-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCCN1C(=O)CCc2cc(N[S](=O)(=O)Cc3ccccc3)ccc12 | OpenEye OEToolkits 1.7.6 | CCCN1c2ccc(cc2CCC1=O)NS(=O)(=O)Cc3ccccc3 | ACDLabs 12.01 | O=S(=O)(Nc1ccc2c(c1)CCC(=O)N2CCC)Cc3ccccc3 |
|
Formula | C19 H22 N2 O3 S |
Name | N-(2-oxo-1-propyl-1,2,3,4-tetrahydroquinolin-6-yl)-1-phenylmethanesulfonamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000008840605
|
PDB chain | 4lga Chain A Residue 900
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|