Structure of PDB 4lc7 Chain A Binding Site BS01 |
|
|
Ligand ID | 1WP |
InChI | InChI=1S/C18H18ClN3O/c19-15-9-13(10-21-11-15)12-4-3-5-14(8-12)18-7-2-1-6-16(18)23-17(20)22-18/h3-5,8-11,16H,1-2,6-7H2,(H2,20,22)/t16-,18-/m1/s1 |
InChIKey | NVRCQOQFKIFZLP-SJLPKXTDSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc(cc(c1)C23CCCCC2OC(=N3)N)c4cc(cnc4)Cl | OpenEye OEToolkits 1.7.6 | c1cc(cc(c1)[C@]23CCCC[C@H]2OC(=N3)N)c4cc(cnc4)Cl | ACDLabs 12.01 | Clc1cc(cnc1)c2cccc(c2)C34N=C(OC4CCCC3)N | CACTVS 3.385 | NC1=N[C@]2(CCCC[C@H]2O1)c3cccc(c3)c4cncc(Cl)c4 | CACTVS 3.385 | NC1=N[C]2(CCCC[CH]2O1)c3cccc(c3)c4cncc(Cl)c4 |
|
Formula | C18 H18 Cl N3 O |
Name | (3aR,7aR)-3a-[3-(5-chloropyridin-3-yl)phenyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-amine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920694
|
PDB chain | 4lc7 Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|