Structure of PDB 4l7u Chain A Binding Site BS01 |
|
|
Ligand ID | 1VC |
InChI | InChI=1S/C21H21N3O4/c1-28-21(27)17(13-14-7-3-2-4-8-14)23-19(25)12-11-18-22-16-10-6-5-9-15(16)20(26)24-18/h2-10,17H,11-13H2,1H3,(H,23,25)(H,22,24,26)/t17-/m0/s1 |
InChIKey | VBHDTUSGPSUCNL-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(OC)C(NC(=O)CCC2=Nc1c(cccc1)C(=O)N2)Cc3ccccc3 | OpenEye OEToolkits 1.7.6 | COC(=O)C(Cc1ccccc1)NC(=O)CCC2=Nc3ccccc3C(=O)N2 | CACTVS 3.370 | COC(=O)[CH](Cc1ccccc1)NC(=O)CCC2=Nc3ccccc3C(=O)N2 | CACTVS 3.370 OpenEye OEToolkits 1.7.6 | COC(=O)[C@H](Cc1ccccc1)NC(=O)CCC2=Nc3ccccc3C(=O)N2 |
|
Formula | C21 H21 N3 O4 |
Name | methyl N-[3-(4-oxo-3,4-dihydroquinazolin-2-yl)propanoyl]-L-phenylalaninate |
ChEMBL | CHEMBL3092523 |
DrugBank | |
ZINC | ZINC000008135174
|
PDB chain | 4l7u Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|