Structure of PDB 4l7l Chain A Binding Site BS01 |
|
|
Ligand ID | 1VA |
InChI | InChI=1S/C20H21N3O3/c24-13-15(12-14-6-2-1-3-7-14)21-19(25)11-10-18-22-17-9-5-4-8-16(17)20(26)23-18/h1-9,15,24H,10-13H2,(H,21,25)(H,22,23,26)/t15-/m0/s1 |
InChIKey | PKPIHOLUWUTPLW-HNNXBMFYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1ccc(cc1)C[C@@H](CO)NC(=O)CCC2=Nc3ccccc3C(=O)N2 | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)CC(CO)NC(=O)CCC2=Nc3ccccc3C(=O)N2 | CACTVS 3.370 | OC[CH](Cc1ccccc1)NC(=O)CCC2=Nc3ccccc3C(=O)N2 | ACDLabs 12.01 | O=C(NC(Cc1ccccc1)CO)CCC3=Nc2c(cccc2)C(=O)N3 | CACTVS 3.370 | OC[C@H](Cc1ccccc1)NC(=O)CCC2=Nc3ccccc3C(=O)N2 |
|
Formula | C20 H21 N3 O3 |
Name | N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-3-(4-oxo-3,4-dihydroquinazolin-2-yl)propanamide |
ChEMBL | CHEMBL3092553 |
DrugBank | |
ZINC | ZINC000098208034
|
PDB chain | 4l7l Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|