Structure of PDB 4l70 Chain A Binding Site BS01 |
|
|
Ligand ID | 1V9 |
InChI | InChI=1S/C20H21N3O2/c1-2-16(14-8-4-3-5-9-14)22-19(24)13-12-18-21-17-11-7-6-10-15(17)20(25)23-18/h3-11,16H,2,12-13H2,1H3,(H,22,24)(H,21,23,25)/t16-/m0/s1 |
InChIKey | YAXDRRKYLDEMKO-INIZCTEOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CCC(c1ccccc1)NC(=O)CCC2=Nc3ccccc3C(=O)N2 | CACTVS 3.370 | CC[C@H](NC(=O)CCC1=Nc2ccccc2C(=O)N1)c3ccccc3 | ACDLabs 12.01 | O=C(NC(c1ccccc1)CC)CCC3=Nc2c(cccc2)C(=O)N3 | OpenEye OEToolkits 1.7.6 | CC[C@@H](c1ccccc1)NC(=O)CCC2=Nc3ccccc3C(=O)N2 | CACTVS 3.370 | CC[CH](NC(=O)CCC1=Nc2ccccc2C(=O)N1)c3ccccc3 |
|
Formula | C20 H21 N3 O2 |
Name | 3-(4-oxo-3,4-dihydroquinazolin-2-yl)-N-[(1S)-1-phenylpropyl]propanamide |
ChEMBL | CHEMBL3092544 |
DrugBank | |
ZINC |
|
PDB chain | 4l70 Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|