Structure of PDB 4kp6 Chain A Binding Site BS01 |
|
|
Ligand ID | 1S1 |
InChI | InChI=1S/C12H17N9/c1-4-12(5-2,6-13)20-10-17-9(14-3)18-11(19-10)21-8-15-7-16-21/h7-8H,4-5H2,1-3H3,(H2,14,17,18,19,20) |
InChIKey | AQTLNSKLZWRJEV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | N#CC(Nc1nc(nc(n1)n2ncnc2)NC)(CC)CC | CACTVS 3.370 | CCC(CC)(Nc1nc(NC)nc(n1)n2cncn2)C#N | OpenEye OEToolkits 1.7.6 | CCC(CC)(C#N)Nc1nc(nc(n1)n2cncn2)NC |
|
Formula | C12 H17 N9 |
Name | 2-ethyl-2-{[4-(methylamino)-6-(1H-1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]amino}butanenitrile |
ChEMBL | CHEMBL2402509 |
DrugBank | |
ZINC | ZINC000095921183
|
PDB chain | 4kp6 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.4.53: 3',5'-cyclic-AMP phosphodiesterase. |
|
|
|