Structure of PDB 4klb Chain A Binding Site BS01 |
|
|
Ligand ID | 1RV |
InChI | InChI=1S/C9H9N5O2S2/c10-7(16)5-1-2-17-8(5)13-6(15)3-18-9-11-4-12-14-9/h1-2,4H,3H2,(H2,10,16)(H,13,15)(H,11,12,14) |
InChIKey | JVENGIHWHCEXOC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | NC(=O)c1ccsc1NC(=O)CSc2[nH]ncn2 | OpenEye OEToolkits 1.7.6 | c1csc(c1C(=O)N)NC(=O)CSc2[nH]ncn2 | ACDLabs 12.01 | O=C(c1c(scc1)NC(=O)CSc2ncnn2)N |
|
Formula | C9 H9 N5 O2 S2 |
Name | 2-{[(1H-1,2,4-triazol-5-ylsulfanyl)acetyl]amino}thiophene-3-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000007603518
|
PDB chain | 4klb Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|