Structure of PDB 4kbz Chain A Binding Site BS01 |
|
|
Ligand ID | 1QA |
InChI | InChI=1S/C19H14N4O4S/c20-8-11-6-14(24)17(21-9-11)18-22-13(10-28-18)7-15(25)23-16(19(26)27)12-4-2-1-3-5-12/h1-6,9-10,16,24H,7H2,(H,23,25)(H,26,27)/t16-/m0/s1 |
InChIKey | KPGRSPXHOOAVBE-INIZCTEOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | OC(=O)[CH](NC(=O)Cc1csc(n1)c2ncc(cc2O)C#N)c3ccccc3 | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)C(C(=O)O)NC(=O)Cc2csc(n2)c3c(cc(cn3)C#N)O | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)[C@@H](C(=O)O)NC(=O)Cc2csc(n2)c3c(cc(cn3)C#N)O | CACTVS 3.370 | OC(=O)[C@@H](NC(=O)Cc1csc(n1)c2ncc(cc2O)C#N)c3ccccc3 | ACDLabs 12.01 | O=C(O)C(c1ccccc1)NC(=O)Cc2nc(sc2)c3ncc(C#N)cc3O |
|
Formula | C19 H14 N4 O4 S |
Name | (2S)-({[2-(5-cyano-3-hydroxypyridin-2-yl)-1,3-thiazol-4-yl]acetyl}amino)(phenyl)ethanoic acid |
ChEMBL | CHEMBL3310395 |
DrugBank | |
ZINC | ZINC000095920821
|
PDB chain | 4kbz Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.14.11.29: hypoxia-inducible factor-proline dioxygenase. |
|
|
|