Structure of PDB 4kbn Chain A Binding Site BS01 |
|
|
Ligand ID | 25U |
InChI | InChI=1S/C19H18N6/c1-2-17-16(18(20)25-19(21)24-17)8-4-6-13-5-3-7-14(9-13)15-10-22-12-23-11-15/h3,5,7,9-12H,2,6H2,1H3,(H4,20,21,24,25) |
InChIKey | UEZKDWYIIOOENX-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | n3c(c(C#CCc2cccc(c1cncnc1)c2)c(nc3N)N)CC | OpenEye OEToolkits 1.7.6 | CCc1c(c(nc(n1)N)N)C#CCc2cccc(c2)c3cncnc3 | CACTVS 3.370 | CCc1nc(N)nc(N)c1C#CCc2cccc(c2)c3cncnc3 |
|
Formula | C19 H18 N6 |
Name | 6-ethyl-5-{3-[3-(pyrimidin-5-yl)phenyl]prop-1-yn-1-yl}pyrimidine-2,4-diamine |
ChEMBL | CHEMBL3644523 |
DrugBank | |
ZINC | ZINC000095921196
|
PDB chain | 4kbn Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
L22 E30 |
Catalytic site (residue number reindexed from 1) |
L22 E30 |
Enzyme Commision number |
1.5.1.3: dihydrofolate reductase. |
|
|
|