Structure of PDB 4k6z Chain A Binding Site BS01 |
|
|
Ligand ID | 1Q3 |
InChI | InChI=1S/C16H15N7O/c17-6-9-2-1-3-12(9)21-15-11-4-5-18-16(24)13(11)22-14(23-15)10-7-19-20-8-10/h5,7-9,12H,1-4H2,(H,19,20)(H,21,22,23)/t9-,12-/m0/s1 |
InChIKey | GGNYHYINELGWQU-CABZTGNLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1c(cn[nH]1)c2nc3c(c(n2)NC4CCCC4C#N)CC=NC3=O | OpenEye OEToolkits 1.7.6 | c1c(cn[nH]1)c2nc3c(c(n2)N[C@H]4CCC[C@H]4C#N)CC=NC3=O | CACTVS 3.370 | O=C1N=CCc2c(N[C@H]3CCC[C@H]3C#N)nc(nc12)c4c[nH]nc4 | ACDLabs 12.01 | N#CC4CCCC4Nc1nc(nc2c1CC=NC2=O)c3cnnc3 | CACTVS 3.370 | O=C1N=CCc2c(N[CH]3CCC[CH]3C#N)nc(nc12)c4c[nH]nc4 |
|
Formula | C16 H15 N7 O |
Name | (1R,2S)-2-{[8-oxo-2-(1H-pyrazol-4-yl)-5,8-dihydropyrido[3,4-d]pyrimidin-4-yl]amino}cyclopentanecarbonitrile |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920652
|
PDB chain | 4k6z Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|