Structure of PDB 4jv9 Chain A Binding Site BS01 |
|
|
Ligand ID | 1MO |
InChI | InChI=1S/C24H21Cl2NO2/c1-27-22(17-7-11-19(25)12-8-17)23(18-9-13-20(26)14-10-18)29-21(24(27)28)15-16-5-3-2-4-6-16/h2-14,21-23H,15H2,1H3/t21-,22+,23-/m0/s1 |
InChIKey | NFFXQTHZDQEVMP-ZRBLBEILSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CN1C(C(OC(C1=O)Cc2ccccc2)c3ccc(cc3)Cl)c4ccc(cc4)Cl | ACDLabs 12.01 | Clc1ccc(cc1)C3OC(C(=O)N(C3c2ccc(Cl)cc2)C)Cc4ccccc4 | CACTVS 3.370 | CN1[C@@H]([C@@H](O[C@@H](Cc2ccccc2)C1=O)c3ccc(Cl)cc3)c4ccc(Cl)cc4 | OpenEye OEToolkits 1.7.6 | CN1[C@@H]([C@@H](O[C@H](C1=O)Cc2ccccc2)c3ccc(cc3)Cl)c4ccc(cc4)Cl | CACTVS 3.370 | CN1[CH]([CH](O[CH](Cc2ccccc2)C1=O)c3ccc(Cl)cc3)c4ccc(Cl)cc4 |
|
Formula | C24 H21 Cl2 N O2 |
Name | (2S,5R,6S)-2-benzyl-5,6-bis(4-chlorophenyl)-4-methylmorpholin-3-one |
ChEMBL | CHEMBL2347401 |
DrugBank | |
ZINC | ZINC000095602510
|
PDB chain | 4jv9 Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.3.2.27: RING-type E3 ubiquitin transferase. |
|
|
|