Structure of PDB 4jt3 Chain A Binding Site BS01 |
|
|
Ligand ID | 1PH |
InChI | InChI=1S/C21H18N4O3S/c22-29(27,28)17-8-4-7-15(12-17)21-18-13-16(9-10-19(18)24-25-21)23-20(26)11-14-5-2-1-3-6-14/h1-10,12-13H,11H2,(H,23,26)(H,24,25)(H2,22,27,28) |
InChIKey | WCYCISQGDVZZOB-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | N[S](=O)(=O)c1cccc(c1)c2[nH]nc3ccc(NC(=O)Cc4ccccc4)cc23 | ACDLabs 12.01 | O=S(=O)(N)c4cccc(c1c2cc(ccc2nn1)NC(=O)Cc3ccccc3)c4 | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)CC(=O)Nc2ccc3c(c2)c([nH]n3)c4cccc(c4)S(=O)(=O)N |
|
Formula | C21 H18 N4 O3 S |
Name | 2-phenyl-N-[3-(3-sulfamoylphenyl)-2H-indazol-5-yl]acetamide |
ChEMBL | CHEMBL3330255 |
DrugBank | |
ZINC | ZINC000098208001
|
PDB chain | 4jt3 Chain A Residue 805
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|