Structure of PDB 4jpe Chain A Binding Site BS01 |
|
|
Ligand ID | 1M7 |
InChI | InChI=1S/C19H21N5O/c1-18(2)7-13-5-4-12(14-8-21-11-22-9-14)6-15(13)19(10-18)16(25)24(3)17(20)23-19/h4-6,8-9,11H,7,10H2,1-3H3,(H2,20,23)/t19-/m1/s1 |
InChIKey | UPOMBIAVTOFWMY-LJQANCHMSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C1N(C(=NC14c3c(ccc(c2cncnc2)c3)CC(C4)(C)C)N)C | OpenEye OEToolkits 1.7.6 | CC1(Cc2ccc(cc2[C@]3(C1)C(=O)N(C(=N3)N)C)c4cncnc4)C | OpenEye OEToolkits 1.7.6 | CC1(Cc2ccc(cc2C3(C1)C(=O)N(C(=N3)N)C)c4cncnc4)C | CACTVS 3.370 | CN1C(=N[C@@]2(CC(C)(C)Cc3ccc(cc23)c4cncnc4)C1=O)N | CACTVS 3.370 | CN1C(=N[C]2(CC(C)(C)Cc3ccc(cc23)c4cncnc4)C1=O)N |
|
Formula | C19 H21 N5 O |
Name | (4R)-2-amino-1,3',3'-trimethyl-7'-(pyrimidin-5-yl)-3',4'-dihydro-2'H-spiro[imidazole-4,1'-naphthalen]-5(1H)-one |
ChEMBL | CHEMBL2349470 |
DrugBank | |
ZINC | ZINC000095603140
|
PDB chain | 4jpe Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|