Structure of PDB 4jpc Chain A Binding Site BS01 |
|
|
Ligand ID | 1M6 |
InChI | InChI=1S/C21H20N4O2/c1-20(2)12-21(18(26)25(3)19(23)24-21)16-10-15(7-8-17(16)27-20)14-6-4-5-13(9-14)11-22/h4-10H,12H2,1-3H3,(H2,23,24)/t21-/m1/s1 |
InChIKey | LASIJFPKQNWUQE-OAQYLSRUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC1(C[C@@]2(c3cc(ccc3O1)c4cccc(c4)C#N)C(=O)N(C(=N2)N)C)C | ACDLabs 12.01 | N#Cc1cccc(c1)c4ccc3OC(CC2(N=C(N(C2=O)C)N)c3c4)(C)C | CACTVS 3.370 | CN1C(=N[C]2(CC(C)(C)Oc3ccc(cc23)c4cccc(c4)C#N)C1=O)N | OpenEye OEToolkits 1.7.6 | CC1(CC2(c3cc(ccc3O1)c4cccc(c4)C#N)C(=O)N(C(=N2)N)C)C | CACTVS 3.370 | CN1C(=N[C@@]2(CC(C)(C)Oc3ccc(cc23)c4cccc(c4)C#N)C1=O)N |
|
Formula | C21 H20 N4 O2 |
Name | 3-[(4R)-2'-amino-1',2,2-trimethyl-5'-oxo-1',2,3,5'-tetrahydrospiro[chromene-4,4'-imidazol]-6-yl]benzonitrile |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095605902
|
PDB chain | 4jpc Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|