Structure of PDB 4joo Chain A Binding Site BS01 |
|
|
Ligand ID | 1M4 |
InChI | InChI=1S/C14H16BrN3O2/c1-13(2)7-14(11(19)18(3)12(16)17-14)9-6-8(15)4-5-10(9)20-13/h4-6H,7H2,1-3H3,(H2,16,17)/t14-/m1/s1 |
InChIKey | GCJNGEZDKLVQNN-CQSZACIVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC1(C[C@@]2(c3cc(ccc3O1)Br)C(=O)N(C(=N2)N)C)C | OpenEye OEToolkits 1.7.6 | CC1(CC2(c3cc(ccc3O1)Br)C(=O)N(C(=N2)N)C)C | CACTVS 3.370 | CN1C(=N[C@@]2(CC(C)(C)Oc3ccc(Br)cc23)C1=O)N | CACTVS 3.370 | CN1C(=N[C]2(CC(C)(C)Oc3ccc(Br)cc23)C1=O)N | ACDLabs 12.01 | Brc3ccc2OC(CC1(N=C(N(C1=O)C)N)c2c3)(C)C |
|
Formula | C14 H16 Br N3 O2 |
Name | (4R)-2'-amino-6-bromo-1',2,2-trimethyl-2,3-dihydrospiro[chromene-4,4'-imidazol]-5'(1'H)-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 4joo Chain A Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|