Structure of PDB 4jnc Chain A Binding Site BS01 |
|
|
Ligand ID | 1LF |
InChI | InChI=1S/C19H23F3N6O/c1-12-25-17(23-2)27-18(26-12)28-9-7-13(8-10-28)16(29)24-11-14-5-3-4-6-15(14)19(20,21)22/h3-6,13H,7-11H2,1-2H3,(H,24,29)(H,23,25,26,27) |
InChIKey | BUWQYHYHSQTERY-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CNc1nc(C)nc(n1)N2CCC(CC2)C(=O)NCc3ccccc3C(F)(F)F | ACDLabs 12.01 | FC(F)(F)c1ccccc1CNC(=O)C3CCN(c2nc(nc(n2)C)NC)CC3 | OpenEye OEToolkits 1.7.6 | Cc1nc(nc(n1)N2CCC(CC2)C(=O)NCc3ccccc3C(F)(F)F)NC |
|
Formula | C19 H23 F3 N6 O |
Name | 1-[4-methyl-6-(methylamino)-1,3,5-triazin-2-yl]-N-[2-(trifluoromethyl)benzyl]piperidine-4-carboxamide |
ChEMBL | CHEMBL2392714 |
DrugBank | |
ZINC | ZINC000095921167
|
PDB chain | 4jnc Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|