Structure of PDB 4jlh Chain A Binding Site BS01 |
|
|
Ligand ID | 0L9 |
InChI | InChI=1S/C19H15BrClNO3/c1-10-16(18(25-2)19(23)24)17(11-3-6-13(21)7-4-11)14-9-12(20)5-8-15(14)22-10/h3-9,18H,1-2H3,(H,23,24)/t18-/m0/s1 |
InChIKey | BNDPDYQQAJUJPY-SFHVURJKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1c(c(c2cc(ccc2n1)Br)c3ccc(cc3)Cl)C(C(=O)O)OC | ACDLabs 12.01 | O=C(O)C(OC)c1c(c2cc(Br)ccc2nc1C)c3ccc(Cl)cc3 | OpenEye OEToolkits 1.7.6 | Cc1c(c(c2cc(ccc2n1)Br)c3ccc(cc3)Cl)[C@@H](C(=O)O)OC | CACTVS 3.370 | CO[CH](C(O)=O)c1c(C)nc2ccc(Br)cc2c1c3ccc(Cl)cc3 | CACTVS 3.370 | CO[C@H](C(O)=O)c1c(C)nc2ccc(Br)cc2c1c3ccc(Cl)cc3 |
|
Formula | C19 H15 Br Cl N O3 |
Name | (2S)-[6-bromo-4-(4-chlorophenyl)-2-methylquinolin-3-yl](methoxy)ethanoic acid |
ChEMBL | CHEMBL3259893 |
DrugBank | |
ZINC |
|
PDB chain | 4jlh Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|