Structure of PDB 4jl1 Chain A Binding Site BS01 |
|
|
Ligand ID | LM5 |
InChI | InChI=1S/C13H18N2O3/c1-8-11(16)12(17)10(15-8)13(18)14-7-9-5-3-2-4-6-9/h2-6,8,10-12,15-17H,7H2,1H3,(H,14,18)/t8-,10+,11+,12-/m0/s1 |
InChIKey | RJAKCSBNEIOVPB-GMNPVEAJSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | C[CH]1N[CH]([CH](O)[CH]1O)C(=O)NCc2ccccc2 | OpenEye OEToolkits 1.7.6 | C[C@H]1[C@H]([C@H]([C@@H](N1)C(=O)NCc2ccccc2)O)O | OpenEye OEToolkits 1.7.6 | CC1C(C(C(N1)C(=O)NCc2ccccc2)O)O | CACTVS 3.370 | C[C@@H]1N[C@H]([C@H](O)[C@@H]1O)C(=O)NCc2ccccc2 | ACDLabs 12.01 | O=C(NCc1ccccc1)C2NC(C)C(O)C2O |
|
Formula | C13 H18 N2 O3 |
Name | (3S,4R,5S)-N-benzyl-3,4-dihydroxy-5-methyl-D-prolinamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920550
|
PDB chain | 4jl1 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|