Structure of PDB 4jik Chain A Binding Site BS01 |
|
|
Ligand ID | 1KO |
InChI | InChI=1S/C18H19ClN6O/c19-12-5-3-11(4-6-12)15-10-25-17(24-15)14(9-22-18(25)16(20)26)23-13-2-1-7-21-8-13/h3-6,9-10,13,21,23H,1-2,7-8H2,(H2,20,26)/t13-/m0/s1 |
InChIKey | VUQDZGWRLHHYTB-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc(ccc1c2cn3c(n2)c(cnc3C(=O)N)NC4CCCNC4)Cl | CACTVS 3.370 | NC(=O)c1ncc(N[C@H]2CCCNC2)c3nc(cn13)c4ccc(Cl)cc4 | CACTVS 3.370 | NC(=O)c1ncc(N[CH]2CCCNC2)c3nc(cn13)c4ccc(Cl)cc4 | OpenEye OEToolkits 1.7.6 | c1cc(ccc1c2cn3c(n2)c(cnc3C(=O)N)N[C@H]4CCCNC4)Cl | ACDLabs 12.01 | Clc4ccc(c1nc2c(cnc(C(=O)N)n2c1)NC3CCCNC3)cc4 |
|
Formula | C18 H19 Cl N6 O |
Name | 2-(4-chlorophenyl)-8-[(3S)-piperidin-3-ylamino]imidazo[1,2-c]pyrimidine-5-carboxamide |
ChEMBL | CHEMBL2381611 |
DrugBank | |
ZINC | ZINC000095920753
|
PDB chain | 4jik Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|