Structure of PDB 4jih Chain A Binding Site BS01 |
|
|
Ligand ID | EPR |
InChI | InChI=1S/C15H13NO3S2/c1-10(7-11-5-3-2-4-6-11)8-12-14(19)16(9-13(17)18)15(20)21-12/h2-8H,9H2,1H3,(H,17,18)/b10-7+,12-8? |
InChIKey | CHNUOJQWGUIOLD-KEBJEMEDSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC(=Cc1ccccc1)C=C2C(=O)N(C(=S)S2)CC(=O)O | CACTVS 3.370 | CC(=C\c1ccccc1)/C=C2/SC(=S)N(CC(O)=O)C2=O | OpenEye OEToolkits 1.7.6 | C/C(=C\c1ccccc1)/C=C2C(=O)N(C(=S)S2)CC(=O)O | ACDLabs 12.01 | S=C1S/C(C(=O)N1CC(=O)O)=C/C(=C/c2ccccc2)C | CACTVS 3.370 | CC(=Cc1ccccc1)C=C2SC(=S)N(CC(O)=O)C2=O |
|
Formula | C15 H13 N O3 S2 |
Name | {5-[(2E)-2-methyl-3-phenylprop-2-en-1-ylidene]-4-oxo-2-thioxo-1,3-thiazolidin-3-yl}acetic acid; Epalrestat |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 4jih Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|