Structure of PDB 4jg7 Chain A Binding Site BS01 |
|
|
Ligand ID | 1LC |
InChI | InChI=1S/C18H14N4O2/c19-9-13(17(20)24)8-11-3-1-4-12(7-11)16(23)15-10-22-18-14(15)5-2-6-21-18/h1-7,10,13H,8H2,(H2,20,24)(H,21,22)/t13-/m1/s1 |
InChIKey | UQJDULLQUOPWND-CYBMUJFWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | NC(=O)[C@H](Cc1cccc(c1)C(=O)c2c[nH]c3ncccc23)C#N | ACDLabs 12.01 | N#CC(C(=O)N)Cc1cccc(c1)C(=O)c3c2cccnc2nc3 | CACTVS 3.370 | NC(=O)[CH](Cc1cccc(c1)C(=O)c2c[nH]c3ncccc23)C#N | OpenEye OEToolkits 1.7.6 | c1cc(cc(c1)C(=O)c2c[nH]c3c2cccn3)CC(C#N)C(=O)N | OpenEye OEToolkits 1.7.6 | c1cc(cc(c1)C(=O)c2c[nH]c3c2cccn3)C[C@H](C#N)C(=O)N |
|
Formula | C18 H14 N4 O2 |
Name | (2R)-2-cyano-3-[3-(1H-pyrrolo[2,3-b]pyridin-3-ylcarbonyl)phenyl]propanamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920700
|
PDB chain | 4jg7 Chain A Residue 801
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|