Structure of PDB 4j1c Chain A Binding Site BS01 |
|
|
Ligand ID | 1HO |
InChI | InChI=1S/C18H13F4N5O2/c19-8-17(18(21,22)9-29-16(24)27-17)12-5-11(2-3-13(12)20)26-15(28)14-4-1-10(6-23)7-25-14/h1-5,7H,8-9H2,(H2,24,27)(H,26,28)/t17-/m1/s1 |
InChIKey | OIFTUNMTFHXWBX-QGZVFWFLSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | FC1(F)C(N=C(OC1)N)(c3cc(NC(=O)c2ncc(C#N)cc2)ccc3F)CF | CACTVS 3.370 | NC1=N[C](CF)(c2cc(NC(=O)c3ccc(cn3)C#N)ccc2F)C(F)(F)CO1 | CACTVS 3.370 | NC1=N[C@](CF)(c2cc(NC(=O)c3ccc(cn3)C#N)ccc2F)C(F)(F)CO1 | OpenEye OEToolkits 1.7.6 | c1cc(c(cc1NC(=O)c2ccc(cn2)C#N)C3(C(COC(=N3)N)(F)F)CF)F | OpenEye OEToolkits 1.7.6 | c1cc(c(cc1NC(=O)c2ccc(cn2)C#N)[C@@]3(C(COC(=N3)N)(F)F)CF)F |
|
Formula | C18 H13 F4 N5 O2 |
Name | N-{3-[(4S)-2-amino-5,5-difluoro-4-(fluoromethyl)-5,6-dihydro-4H-1,3-oxazin-4-yl]-4-fluorophenyl}-5-cyanopyridine-2-carboxamide |
ChEMBL | CHEMBL2347190 |
DrugBank | |
ZINC | ZINC000095601495
|
PDB chain | 4j1c Chain A Residue 504
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|