Structure of PDB 4j0v Chain A Binding Site BS01 |
|
|
Ligand ID | 1H7 |
InChI | InChI=1S/C18H15F2N5O2/c1-18(15(20)9-27-17(22)25-18)12-6-11(3-4-13(12)19)24-16(26)14-5-2-10(7-21)8-23-14/h2-6,8,15H,9H2,1H3,(H2,22,25)(H,24,26)/t15-,18+/m0/s1 |
InChIKey | ALKHFUPBQSAGMS-MAUKXSAKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC1(C(COC(=N1)N)F)c2cc(ccc2F)NC(=O)c3ccc(cn3)C#N | CACTVS 3.370 | C[C]1(N=C(N)OC[CH]1F)c2cc(NC(=O)c3ccc(cn3)C#N)ccc2F | OpenEye OEToolkits 1.7.6 | C[C@]1([C@H](COC(=N1)N)F)c2cc(ccc2F)NC(=O)c3ccc(cn3)C#N | CACTVS 3.370 | C[C@@]1(N=C(N)OC[C@@H]1F)c2cc(NC(=O)c3ccc(cn3)C#N)ccc2F | ACDLabs 12.01 | FC1C(N=C(OC1)N)(c3cc(NC(=O)c2ncc(C#N)cc2)ccc3F)C |
|
Formula | C18 H15 F2 N5 O2 |
Name | N-{3-[(4R,5R)-2-amino-5-fluoro-4-methyl-5,6-dihydro-4H-1,3-oxazin-4-yl]-4-fluorophenyl}-5-cyanopyridine-2-carboxamide |
ChEMBL | CHEMBL2347204 |
DrugBank | |
ZINC | ZINC000095604687
|
PDB chain | 4j0v Chain A Residue 504
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|