Structure of PDB 4j0t Chain A Binding Site BS01 |
|
|
Ligand ID | 6T9 |
InChI | InChI=1S/C19H19F3N4O3/c1-3-28-12-5-7-15(24-9-12)16(27)25-11-4-6-14(20)13(8-11)18(2)19(21,22)10-29-17(23)26-18/h4-9H,3,10H2,1-2H3,(H2,23,26)(H,25,27)/t18-/m1/s1 |
InChIKey | DWKGLYKXNUIYDM-GOSISDBHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCOc1ccc(nc1)C(=O)Nc2ccc(F)c(c2)[C]3(C)N=C(N)OCC3(F)F | OpenEye OEToolkits 1.9.2 | CCOc1ccc(nc1)C(=O)Nc2ccc(c(c2)C3(C(COC(=N3)N)(F)F)C)F | OpenEye OEToolkits 1.9.2 | CCOc1ccc(nc1)C(=O)Nc2ccc(c(c2)[C@@]3(C(COC(=N3)N)(F)F)C)F | CACTVS 3.385 | CCOc1ccc(nc1)C(=O)Nc2ccc(F)c(c2)[C@@]3(C)N=C(N)OCC3(F)F | ACDLabs 12.01 | FC1(F)C(N=C(OC1)N)(c3cc(NC(=O)c2ncc(OCC)cc2)ccc3F)C |
|
Formula | C19 H19 F3 N4 O3 |
Name | 5-Ethoxy-pyridine-2-carboxylic acid [3-((R)-2-amino-5,5-difluoro-4-methyl-5,6-dihydro-4H-[1,3]oxazin-4-yl)-4-fluoro-phenyl]-amide |
ChEMBL | CHEMBL2347367 |
DrugBank | |
ZINC | ZINC000095601198
|
PDB chain | 4j0t Chain A Residue 504
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|