Structure of PDB 4ivd Chain A Binding Site BS01 |
|
|
Ligand ID | 15T |
InChI | InChI=1S/C19H23N5O/c1-12(25)19-23-16-11-22-18-15(8-10-21-18)17(16)24(19)14-6-4-13(5-7-14)3-2-9-20/h8,10-14,25H,2-7H2,1H3,(H,21,22)/t12-,13-,14-/m1/s1 |
InChIKey | LLRNGFSFYHDPKW-MGPQQGTHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C[C@H](c1nc2cnc3c(c2n1C4CCC(CC4)CCC#N)cc[nH]3)O | OpenEye OEToolkits 1.7.6 | CC(c1nc2cnc3c(c2n1C4CCC(CC4)CCC#N)cc[nH]3)O | CACTVS 3.370 | C[CH](O)c1nc2cnc3[nH]ccc3c2n1[CH]4CC[CH](CCC#N)CC4 | CACTVS 3.370 | C[C@@H](O)c1nc2cnc3[nH]ccc3c2n1[C@H]4CC[C@H](CCC#N)CC4 | ACDLabs 12.01 | N#CCCC4CCC(n3c(nc2cnc1nccc1c23)C(O)C)CC4 |
|
Formula | C19 H23 N5 O |
Name | 3-(trans-4-{2-[(1R)-1-hydroxyethyl]imidazo[4,5-d]pyrrolo[2,3-b]pyridin-1(6H)-yl}cyclohexyl)propanenitrile |
ChEMBL | CHEMBL2386636 |
DrugBank | |
ZINC |
|
PDB chain | 4ivd Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|