Structure of PDB 4iva Chain A Binding Site BS01 |
|
|
Ligand ID | 1J5 |
InChI | InChI=1S/C17H19N5O/c1-10(23)17-21-14-9-20-16-13(6-7-19-16)15(14)22(17)12-4-2-11(8-18)3-5-12/h6-7,9-12,23H,2-5H2,1H3,(H,19,20)/t10-,11-,12-/m1/s1 |
InChIKey | ANDWOIMHOOWCLK-IJLUTSLNSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C[C@H](c1nc2cnc3c(c2n1C4CCC(CC4)C#N)cc[nH]3)O | ACDLabs 12.01 | N#CC4CCC(n3c(nc2cnc1nccc1c23)C(O)C)CC4 | OpenEye OEToolkits 1.7.6 | CC(c1nc2cnc3c(c2n1C4CCC(CC4)C#N)cc[nH]3)O | CACTVS 3.370 | C[CH](O)c1nc2cnc3[nH]ccc3c2n1[CH]4CC[CH](CC4)C#N | CACTVS 3.370 | C[C@@H](O)c1nc2cnc3[nH]ccc3c2n1[C@H]4CC[C@@H](CC4)C#N |
|
Formula | C17 H19 N5 O |
Name | trans-4-{2-[(1R)-1-hydroxyethyl]imidazo[4,5-d]pyrrolo[2,3-b]pyridin-1(6H)-yl}cyclohexanecarbonitrile |
ChEMBL | CHEMBL2386633 |
DrugBank | |
ZINC | ZINC000101680566
|
PDB chain | 4iva Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|