Structure of PDB 4iku Chain A Binding Site BS01 |
|
|
Ligand ID | SHX |
InChI | InChI=1S/C19H18ClN5O/c1-12-16(20)19(25-18(23-12)14-9-5-6-10-22-14)24-15(17(21)26)11-13-7-3-2-4-8-13/h2-10,15H,11H2,1H3,(H2,21,26)(H,23,24,25)/t15-/m1/s1 |
InChIKey | SELSGPMCFPHSDG-OAHLLOKOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | Cc1nc(nc(N[C@H](Cc2ccccc2)C(N)=O)c1Cl)c3ccccn3 | CACTVS 3.370 | Cc1nc(nc(N[CH](Cc2ccccc2)C(N)=O)c1Cl)c3ccccn3 | OpenEye OEToolkits 1.7.6 | Cc1c(c(nc(n1)c2ccccn2)N[C@H](Cc3ccccc3)C(=O)N)Cl | OpenEye OEToolkits 1.7.6 | Cc1c(c(nc(n1)c2ccccn2)NC(Cc3ccccc3)C(=O)N)Cl | ACDLabs 12.01 | O=C(N)C(Nc1nc(nc(c1Cl)C)c2ncccc2)Cc3ccccc3 |
|
Formula | C19 H18 Cl N5 O |
Name | Nalpha-[5-chloro-6-methyl-2-(pyridin-2-yl)pyrimidin-4-yl]-D-phenylalaninamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098209409
|
PDB chain | 4iku Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|