Structure of PDB 4igr Chain A Binding Site BS01 |
|
|
Ligand ID | 3ZA |
InChI | InChI=1S/C9H16N2O6/c1-11(17)7(12)3-2-5(8(13)14)4-6(10)9(15)16/h5-6,17H,2-4,10H2,1H3,(H,13,14)(H,15,16)/t5-,6+/m1/s1 |
InChIKey | YWTXUGAXXGHUOR-RITPCOANSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CN(O)C(=O)CC[CH](C[CH](N)C(O)=O)C(O)=O | CACTVS 3.370 | CN(O)C(=O)CC[C@H](C[C@H](N)C(O)=O)C(O)=O | ACDLabs 12.01 | O=C(N(O)C)CCC(C(=O)O)CC(C(=O)O)N | OpenEye OEToolkits 1.7.6 | CN(C(=O)CC[C@H](C[C@@H](C(=O)O)N)C(=O)O)O | OpenEye OEToolkits 1.7.6 | CN(C(=O)CCC(CC(C(=O)O)N)C(=O)O)O |
|
Formula | C9 H16 N2 O6 |
Name | (4R)-4-{3-[hydroxy(methyl)amino]-3-oxopropyl}-L-glutamic acid |
ChEMBL | CHEMBL2312403 |
DrugBank | |
ZINC | ZINC000095596091
|
PDB chain | 4igr Chain A Residue 901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|