Structure of PDB 4idt Chain A Binding Site BS01 |
|
|
Ligand ID | T28 |
InChI | InChI=1S/C15H13BrN4/c16-9-4-5-11-10(6-9)13-12(19-11)3-1-2-8-7-18-15(17)20-14(8)13/h4-7,19H,1-3H2,(H2,17,18,20) |
InChIKey | MEOWHQIIZUZBTO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Brc3cc4c2c1nc(ncc1CCCc2nc4cc3)N | OpenEye OEToolkits 1.7.6 | c1cc2c(cc1Br)c-3c([nH]2)CCCc4c3nc(nc4)N | CACTVS 3.370 | Nc1ncc2CCCc3[nH]c4ccc(Br)cc4c3c2n1 |
|
Formula | C15 H13 Br N4 |
Name | 11-bromo-5,6,7,8-tetrahydropyrimido[4',5':3,4]cyclohepta[1,2-b]indol-2-amine |
ChEMBL | CHEMBL2334583 |
DrugBank | |
ZINC | ZINC000095592824
|
PDB chain | 4idt Chain A Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|