Structure of PDB 4i9z Chain A Binding Site BS01 |
|
|
Ligand ID | 5BA |
InChI | InChI=1S/C23H31BrN4O3/c1-5-12-31-19-7-6-16(18(29)14-28-10-8-27(4)9-11-28)13-17(19)22-25-21(15(2)3)20(24)23(30)26-22/h6-7,13,15H,5,8-12,14H2,1-4H3,(H,25,26,30) |
InChIKey | WTKMCYZVMOTXKM-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCCOc1ccc(cc1C2=NC(=C(Br)C(=O)N2)C(C)C)C(=O)CN3CCN(C)CC3 | OpenEye OEToolkits 1.7.6 | CCCOc1ccc(cc1C2=NC(=C(C(=O)N2)Br)C(C)C)C(=O)CN3CCN(CC3)C | ACDLabs 12.01 | O=C(c2ccc(OCCC)c(C1=NC(=C(Br)C(=O)N1)C(C)C)c2)CN3CCN(CC3)C |
|
Formula | C23 H31 Br N4 O3 |
Name | 5-bromo-2-{5-[(4-methylpiperazin-1-yl)acetyl]-2-propoxyphenyl}-6-(propan-2-yl)pyrimidin-4(3H)-one |
ChEMBL | CHEMBL2414314 |
DrugBank | |
ZINC | ZINC000095921232
|
PDB chain | 4i9z Chain A Residue 901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.4.35: 3',5'-cyclic-GMP phosphodiesterase. |
|
|
|