Structure of PDB 4i71 Chain A Binding Site BS01 |
|
|
Ligand ID | AGV |
InChI | InChI=1S/C12H17N5O3/c13-12-10-9(15-5-16-12)6(1-14-10)2-17-3-8(19)11(20)7(17)4-18/h1,5,7-8,11,14,18-20H,2-4H2,(H2,13,15,16)/t7-,8+,11-/m1/s1 |
InChIKey | RCLRGJMFVIDWTM-VHSKPIJISA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | Nc1ncnc2c(CN3C[CH](O)[CH](O)[CH]3CO)c[nH]c12 | OpenEye OEToolkits 1.7.6 | c1c(c2c([nH]1)c(ncn2)N)CN3C[C@@H]([C@@H]([C@H]3CO)O)O | OpenEye OEToolkits 1.7.6 | c1c(c2c([nH]1)c(ncn2)N)CN3CC(C(C3CO)O)O | ACDLabs 12.01 | OCC3N(Cc2cnc1c2ncnc1N)CC(O)C3O | CACTVS 3.370 | Nc1ncnc2c(CN3C[C@H](O)[C@H](O)[C@H]3CO)c[nH]c12 |
|
Formula | C12 H17 N5 O3 |
Name | (2R,3R,4S)-1-[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methyl]-2-(hydroxymethyl)pyrrolidine-3,4-diol |
ChEMBL | CHEMBL493457 |
DrugBank | |
ZINC | ZINC000040430062
|
PDB chain | 4i71 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.2.2.1: purine nucleosidase. |
|
|
|