Structure of PDB 4i6h Chain A Binding Site BS01 |
|
|
Ligand ID | 1C8 |
InChI | InChI=1S/C20H23N7OS/c1-3-15-19(28)25(2)16-10-22-20(24-18(16)27(15)13-6-4-5-7-13)26-9-8-21-17(26)14-11-29-12-23-14/h8-13,15H,3-7H2,1-2H3/t15-/m1/s1 |
InChIKey | HGHXLCCYGNWFLX-OAHLLOKOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CC[CH]1N(C2CCCC2)c3nc(ncc3N(C)C1=O)n4ccnc4c5cscn5 | CACTVS 3.370 | CC[C@H]1N(C2CCCC2)c3nc(ncc3N(C)C1=O)n4ccnc4c5cscn5 | OpenEye OEToolkits 1.7.6 | CCC1C(=O)N(c2cnc(nc2N1C3CCCC3)n4ccnc4c5cscn5)C | OpenEye OEToolkits 1.7.6 | CC[C@@H]1C(=O)N(c2cnc(nc2N1C3CCCC3)n4ccnc4c5cscn5)C | ACDLabs 12.01 | O=C5N(c1c(nc(nc1)n2ccnc2c3ncsc3)N(C4CCCC4)C5CC)C |
|
Formula | C20 H23 N7 O S |
Name | (7R)-8-cyclopentyl-7-ethyl-5-methyl-2-[2-(1,3-thiazol-4-yl)-1H-imidazol-1-yl]-7,8-dihydropteridin-6(5H)-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921025
|
PDB chain | 4i6h Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|