Structure of PDB 4i5p Chain A Binding Site BS01 |
|
|
Ligand ID | 1D1 |
InChI | InChI=1S/C18H23N5O/c1-3-14-18(24)22(2)15-11-20-16(13-9-6-10-19-13)21-17(15)23(14)12-7-4-5-8-12/h6,9-12,14,19H,3-5,7-8H2,1-2H3/t14-/m1/s1 |
InChIKey | DBHNCRPFJNHKDP-CQSZACIVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC[C@@H]1C(=O)N(c2cnc(nc2N1C3CCCC3)c4ccc[nH]4)C | CACTVS 3.370 | CC[C@H]1N(C2CCCC2)c3nc(ncc3N(C)C1=O)c4[nH]ccc4 | CACTVS 3.370 | CC[CH]1N(C2CCCC2)c3nc(ncc3N(C)C1=O)c4[nH]ccc4 | ACDLabs 12.01 | O=C1N(c3cnc(nc3N(C1CC)C2CCCC2)c4cccn4)C | OpenEye OEToolkits 1.7.6 | CCC1C(=O)N(c2cnc(nc2N1C3CCCC3)c4ccc[nH]4)C |
|
Formula | C18 H23 N5 O |
Name | (7R)-8-cyclopentyl-7-ethyl-5-methyl-2-(1H-pyrrol-2-yl)-7,8-dihydropteridin-6(5H)-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921023
|
PDB chain | 4i5p Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|