Structure of PDB 4i5c Chain A Binding Site BS01 |
|
|
Ligand ID | C5I |
InChI | InChI=1S/C15H15N7O/c16-5-3-13(23)21-7-1-2-10(9-21)22-14-11-4-6-17-15(11)18-8-12(14)19-20-22/h4,6,8,10H,1-3,7,9H2,(H,17,18)/t10-/m1/s1 |
InChIKey | COGIAVJREKAVDL-SNVBAGLBSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1c[nH]c2c1c3c(cn2)nnn3C4CCCN(C4)C(=O)CC#N | OpenEye OEToolkits 1.7.6 | c1c[nH]c2c1c3c(cn2)nnn3[C@@H]4CCCN(C4)C(=O)CC#N | CACTVS 3.370 | O=C(CC#N)N1CCC[C@H](C1)n2nnc3cnc4[nH]ccc4c23 | ACDLabs 12.01 | N#CCC(=O)N4CCCC(n3nnc2cnc1nccc1c23)C4 | CACTVS 3.370 | O=C(CC#N)N1CCC[CH](C1)n2nnc3cnc4[nH]ccc4c23 |
|
Formula | C15 H15 N7 O |
Name | 3-oxo-3-[(3R)-3-(pyrrolo[2,3-b][1,2,3]triazolo[4,5-d]pyridin-1(6H)-yl)piperidin-1-yl]propanenitrile |
ChEMBL | CHEMBL2392500 |
DrugBank | |
ZINC | ZINC000095920658
|
PDB chain | 4i5c Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|